C20H27Cl3N2O2 — CID 17159776
N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 17159776) has the molecular formula C20H27Cl3N2O2 and a molecular weight of 433.81 g/mol. Its IUPAC name is N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17159776 |
| Molecular Formula | C20H27Cl3N2O2 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cc(CNCCN2CCOCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25ClN2O2.2ClH/c21-19-14-18(15-22-8-9-23-10-12-24-13-11-23)6-7-20(19)25-16-17-4-2-1-3-5-17;;/h1-7,14,22H,8-13,15-16H2;2*1H |
| InChIKey | ILRKGOCTLJVJGH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|