C23H34Cl2N2O3 — CID 17289415
N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 17289415) has the molecular formula C23H34Cl2N2O3 and a molecular weight of 457.44 g/mol. Its IUPAC name is N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17289415 |
| Molecular Formula | C23H34Cl2N2O3 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | CCOc1cc(CNCCCN2CCOCC2)ccc1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H32N2O3.2ClH/c1-2-27-23-17-21(18-24-11-6-12-25-13-15-26-16-14-25)9-10-22(23)28-19-20-7-4-3-5-8-20;;/h3-5,7-10,17,24H,2,6,11-16,18-19H2,1H3;2*1H |
| InChIKey | QTJNQNYBEBDOSV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|