C21H29Cl2FN2O2 — CID 17289404
N-[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 17289404) has the molecular formula C21H29Cl2FN2O2 and a molecular weight of 431.38 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17289404 |
| Molecular Formula | C21H29Cl2FN2O2 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[[2-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(COc2ccccc2CNCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27FN2O2.2ClH/c22-20-8-6-18(7-9-20)17-26-21-5-2-1-4-19(21)16-23-10-3-11-24-12-14-25-15-13-24;;/h1-2,4-9,23H,3,10-17H2;2*1H |
| InChIKey | OCNUHXSVRNCFNS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|