C22H31Cl3N2O3 — CID 17289346
N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 17289346) has the molecular formula C22H31Cl3N2O3 and a molecular weight of 477.86 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17289346 |
| Molecular Formula | C22H31Cl3N2O3 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | COc1cccc(CNCCCN2CCOCC2)c1OCc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C22H29ClN2O3.2ClH/c1-26-21-5-2-4-19(16-24-10-3-11-25-12-14-27-15-13-25)22(21)28-17-18-6-8-20(23)9-7-18;;/h2,4-9,24H,3,10-17H2,1H3;2*1H |
| InChIKey | UNGZKZAFRZWODS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|