C23H33Cl3N2O3 — CID 17055552
N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 17055552) has the molecular formula C23H33Cl3N2O3 and a molecular weight of 491.89 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17055552 |
| Molecular Formula | C23H33Cl3N2O3 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | COc1cc(CNCCCN2CCOCC2)cc(Cl)c1OCc1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H31ClN2O3.2ClH/c1-18-4-6-19(7-5-18)17-29-23-21(24)14-20(15-22(23)27-2)16-25-8-3-9-26-10-12-28-13-11-26;;/h4-7,14-15,25H,3,8-13,16-17H2,1-2H3;2*1H |
| InChIKey | ZBNASCURUQZDSQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|