C24H35BrCl2N2O3 — CID 17055302
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride (PubChem CID 17055302) has the molecular formula C24H35BrCl2N2O3 and a molecular weight of 550.37 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17055302 |
| Molecular Formula | C24H35BrCl2N2O3 |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine;dihydrochloride |
| SMILES | CCOc1cc(CNCCCN2CCOCC2)cc(Br)c1OCc1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C24H33BrN2O3.2ClH/c1-3-29-23-16-21(17-26-9-4-10-27-11-13-28-14-12-27)15-22(25)24(23)30-18-20-7-5-19(2)6-8-20;;/h5-8,15-16,26H,3-4,9-14,17-18H2,1-2H3;2*1H |
| InChIKey | UGWAFPXWVKSRNV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|