C23H30BrFN2O3 — CID 4722087
N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 4722087) has the molecular formula C23H30BrFN2O3 and a molecular weight of 481.41 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 4722087 |
| Molecular Formula | C23H30BrFN2O3 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | CCOc1cc(CNCCCN2CCOCC2)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H30BrFN2O3/c1-2-29-22-15-19(16-26-8-3-9-27-10-12-28-13-11-27)14-21(24)23(22)30-17-18-4-6-20(25)7-5-18/h4-7,14-15,26H,2-3,8-13,16-17H2,1H3 |
| InChIKey | JEMBYLGAEOJQFM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|