C20H25BrFNO3 — CID 17209299
N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxypropan-1-amine (PubChem CID 17209299) has the molecular formula C20H25BrFNO3 and a molecular weight of 426.33 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 17209299 |
| Molecular Formula | C20H25BrFNO3 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-methoxypropan-1-amine |
| SMILES | CCOc1cc(CNCCCOC)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25BrFNO3/c1-3-25-19-12-16(13-23-9-4-10-24-2)11-18(21)20(19)26-14-15-5-7-17(22)8-6-15/h5-8,11-12,23H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | VLMVTACLJLJCPS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|