C21H28Cl2FNO3 — CID 17290637
N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17290637) has the molecular formula C21H28Cl2FNO3 and a molecular weight of 432.36 g/mol. Its IUPAC name is N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17290637 |
| Molecular Formula | C21H28Cl2FNO3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1cc(Cl)c(OCc2ccc(F)cc2)c(OCC)c1.Cl |
| InChI | InChI=1S/C21H27ClFNO3.ClH/c1-3-25-11-5-10-24-14-17-12-19(22)21(20(13-17)26-4-2)27-15-16-6-8-18(23)9-7-16;/h6-9,12-13,24H,3-5,10-11,14-15H2,1-2H3;1H |
| InChIKey | VRNHWLWXUFERSO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|