C22H29ClFNO3 — CID 17207705
3-butoxy-N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine (PubChem CID 17207705) has the molecular formula C22H29ClFNO3 and a molecular weight of 409.93 g/mol. Its IUPAC name is 3-butoxy-N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 17207705 |
| Molecular Formula | C22H29ClFNO3 |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-butoxy-N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1cc(Cl)c(OCc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H29ClFNO3/c1-3-4-11-27-12-5-10-25-15-18-13-20(23)22(21(14-18)26-2)28-16-17-6-8-19(24)9-7-17/h6-9,13-14,25H,3-5,10-12,15-16H2,1-2H3 |
| InChIKey | BPKZTORWFQOMSR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|