C19H24Cl3FN2O2-2 — CID 21233350
N'-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine dichloride (PubChem CID 21233350) has the molecular formula C19H24Cl3FN2O2-2 and a molecular weight of 437.77 g/mol. Its IUPAC name is N'-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine dichloride.
| Compound Name | N'-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine dichloride |
|---|---|
| PubChem CID | 21233350 |
| Molecular Formula | C19H24Cl3FN2O2-2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N'-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine dichloride |
| SMILES | CNCCCNCc1cc(Cl)c(OCc2ccc(F)cc2)c(OC)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C19H24ClFN2O2.2ClH/c1-22-8-3-9-23-12-15-10-17(20)19(18(11-15)24-2)25-13-14-4-6-16(21)7-5-14;;/h4-7,10-11,22-23H,3,8-9,12-13H2,1-2H3;2*1H/p-2 |
| InChIKey | NUJMOCGLEWAEDE-UHFFFAOYSA-L |
| XLogP | -2.23 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|