C17H25Cl3N2O2S — CID 17333153
N'-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride (PubChem CID 17333153) has the molecular formula C17H25Cl3N2O2S and a molecular weight of 427.83 g/mol. Its IUPAC name is N'-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17333153 |
| Molecular Formula | C17H25Cl3N2O2S |
| Molecular Weight | 427.83 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N'-[[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
| SMILES | CNCCCNCc1cc(Cl)c(OCc2cccs2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C17H23ClN2O2S.2ClH/c1-19-6-4-7-20-11-13-9-15(18)17(16(10-13)21-2)22-12-14-5-3-8-23-14;;/h3,5,8-10,19-20H,4,6-7,11-12H2,1-2H3;2*1H |
| InChIKey | ZEPAQINENGHULU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|