C14H17Cl2NO2S — CID 17290121
1-[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine;hydrochloride (PubChem CID 17290121) has the molecular formula C14H17Cl2NO2S and a molecular weight of 334.27 g/mol. Its IUPAC name is 1-[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 17290121 |
| Molecular Formula | C14H17Cl2NO2S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cc(Cl)c(OCc2cccs2)c(OC)c1.Cl |
| InChI | InChI=1S/C14H16ClNO2S.ClH/c1-16-8-10-6-12(15)14(13(7-10)17-2)18-9-11-4-3-5-19-11;/h3-7,16H,8-9H2,1-2H3;1H |
| InChIKey | NQMHEJWSRBPFDE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |