C20H27ClNO2S+ — CID 8637930
[3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-cycloheptylazanium (PubChem CID 8637930) has the molecular formula C20H27ClNO2S+ and a molecular weight of 380.96 g/mol. Its IUPAC name is [3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-cycloheptylazanium.
| Compound Name | [3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-cycloheptylazanium |
|---|---|
| PubChem CID | 8637930 |
| Molecular Formula | C20H27ClNO2S+ |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [3-chloro-5-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-cycloheptylazanium |
| SMILES | COc1cc(C[NH2+]C2CCCCCC2)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C20H26ClNO2S/c1-23-19-12-15(13-22-16-7-4-2-3-5-8-16)11-18(21)20(19)24-14-17-9-6-10-25-17/h6,9-12,16,22H,2-5,7-8,13-14H2,1H3/p+1 |
| InChIKey | RXFXXMURGIJTDB-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |