C20H22ClN2O2S+ — CID 4137204
[3-chloro-5-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(pyridin-3-ylmethyl)azanium (PubChem CID 4137204) has the molecular formula C20H22ClN2O2S+ and a molecular weight of 389.93 g/mol. Its IUPAC name is [3-chloro-5-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | [3-chloro-5-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 4137204 |
| Molecular Formula | C20H22ClN2O2S+ |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [3-chloro-5-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(pyridin-3-ylmethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2cccnc2)cc(Cl)c1OCc1cccs1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-24-19-10-16(13-23-12-15-5-3-7-22-11-15)9-18(21)20(19)25-14-17-6-4-8-26-17/h3-11,23H,2,12-14H2,1H3/p+1 |
| InChIKey | QGJYVFKRKHGRFZ-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |