C16H20ClN2O3S+ — CID 7248526
[4-(2-amino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 7248526) has the molecular formula C16H20ClN2O3S+ and a molecular weight of 355.87 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7248526 |
| Molecular Formula | C16H20ClN2O3S+ |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2cccs2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C16H19ClN2O3S/c1-2-21-14-7-11(8-19-9-12-4-3-5-23-12)6-13(17)16(14)22-10-15(18)20/h3-7,19H,2,8-10H2,1H3,(H2,18,20)/p+1 |
| InChIKey | QAGVRJQTBANUBS-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |