C15H18BrN2O3S+ — CID 7380579
[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 7380579) has the molecular formula C15H18BrN2O3S+ and a molecular weight of 386.29 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7380579 |
| Molecular Formula | C15H18BrN2O3S+ |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1cc(C[NH2+]Cc2cccs2)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C15H17BrN2O3S/c1-20-13-6-10(7-18-8-11-3-2-4-22-11)5-12(16)15(13)21-9-14(17)19/h2-6,18H,7-9H2,1H3,(H2,17,19)/p+1 |
| InChIKey | QCTPUAKLLMZNPT-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |