C15H24BrClN2O3 — CID 17291007
2-[2-bromo-6-methoxy-4-[(pentylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17291007) has the molecular formula C15H24BrClN2O3 and a molecular weight of 395.73 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(pentylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(pentylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17291007 |
| Molecular Formula | C15H24BrClN2O3 |
| Molecular Weight | 395.73 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(pentylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | CCCCCNCc1cc(Br)c(OCC(N)=O)c(OC)c1.Cl |
| InChI | InChI=1S/C15H23BrN2O3.ClH/c1-3-4-5-6-18-9-11-7-12(16)15(13(8-11)20-2)21-10-14(17)19;/h7-8,18H,3-6,9-10H2,1-2H3,(H2,17,19);1H |
| InChIKey | NKWIZIPQPBVMMT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|