C13H19BrN2O4 — CID 83210828
2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]ethyl carbamate (PubChem CID 83210828) has the molecular formula C13H19BrN2O4 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]ethyl carbamate.
| Compound Name | 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210828 |
| Molecular Formula | C13H19BrN2O4 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]ethyl carbamate |
| SMILES | CCOc1c(Br)cc(CNCCOC(N)=O)cc1OC |
| InChI | InChI=1S/C13H19BrN2O4/c1-3-19-12-10(14)6-9(7-11(12)18-2)8-16-4-5-20-13(15)17/h6-7,16H,3-5,8H2,1-2H3,(H2,15,17) |
| InChIKey | ZXPSZAKKMHXYBL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|