C18H21BrClNO4 — CID 17295691
4-[[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 17295691) has the molecular formula C18H21BrClNO4 and a molecular weight of 430.73 g/mol. Its IUPAC name is 4-[[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17295691 |
| Molecular Formula | C18H21BrClNO4 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 4-[[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | CCOc1c(Br)cc(CNCc2ccc(C(=O)O)cc2)cc1OC.Cl |
| InChI | InChI=1S/C18H20BrNO4.ClH/c1-3-24-17-15(19)8-13(9-16(17)23-2)11-20-10-12-4-6-14(7-5-12)18(21)22;/h4-9,20H,3,10-11H2,1-2H3,(H,21,22);1H |
| InChIKey | SGSCHXXJWSHHRJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |