C17H20ClNO3 — CID 6458588
4-[[(4-ethoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 6458588) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 4-[[(4-ethoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[(4-ethoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 6458588 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[[(4-ethoxyphenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | CCOc1ccc(CNCc2ccc(C(=O)O)cc2)cc1.Cl |
| InChI | InChI=1S/C17H19NO3.ClH/c1-2-21-16-9-5-14(6-10-16)12-18-11-13-3-7-15(8-4-13)17(19)20;/h3-10,18H,2,11-12H2,1H3,(H,19,20);1H |
| InChIKey | LNZCNUYZHZJJMZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |