C17H18N2O3S — CID 17284489
4-[[(4-ethoxyphenyl)carbamothioylamino]methyl]benzoic acid (PubChem CID 17284489) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-[[(4-ethoxyphenyl)carbamothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[(4-ethoxyphenyl)carbamothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 17284489 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[[(4-ethoxyphenyl)carbamothioylamino]methyl]benzoic acid |
| SMILES | CCOc1ccc(NC(=S)NCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-2-22-15-9-7-14(8-10-15)19-17(23)18-11-12-3-5-13(6-4-12)16(20)21/h3-10H,2,11H2,1H3,(H,20,21)(H2,18,19,23) |
| InChIKey | WTHDKRWWQFABHX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|