C17H20N2NdO2S — CID 87072028
1,3-bis(4-ethoxyphenyl)thiourea;neodymium (PubChem CID 87072028) has the molecular formula C17H20N2NdO2S and a molecular weight of 460.67 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)thiourea;neodymium.
| Compound Name | 1,3-bis(4-ethoxyphenyl)thiourea;neodymium |
|---|---|
| PubChem CID | 87072028 |
| Molecular Formula | C17H20N2NdO2S |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)thiourea;neodymium |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1.[Nd] |
| InChI | InChI=1S/C17H20N2O2S.Nd/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;/h5-12H,3-4H2,1-2H3,(H2,18,19,22); |
| InChIKey | CNYYRWMCSYGNQX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|