C21H26N6O4S2 — CID 2831126
1-(4-ethoxyphenyl)-3-[[3-[2-[(4-ethoxyphenyl)carbamothioyl]hydrazinyl]-3-oxopropanoyl]amino]thiourea (PubChem CID 2831126) has the molecular formula C21H26N6O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[[3-[2-[(4-ethoxyphenyl)carbamothioyl]hydrazinyl]-3-oxopropanoyl]amino]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[[3-[2-[(4-ethoxyphenyl)carbamothioyl]hydrazinyl]-3-oxopropanoyl]amino]thiourea |
|---|---|
| PubChem CID | 2831126 |
| Molecular Formula | C21H26N6O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[[3-[2-[(4-ethoxyphenyl)carbamothioyl]hydrazinyl]-3-oxopropanoyl]amino]thiourea |
| SMILES | CCOc1ccc(NC(=S)NNC(=O)CC(=O)NNC(=S)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C21H26N6O4S2/c1-3-30-16-9-5-14(6-10-16)22-20(32)26-24-18(28)13-19(29)25-27-21(33)23-15-7-11-17(12-8-15)31-4-2/h5-12H,3-4,13H2,1-2H3,(H,24,28)(H,25,29)(H2,22,26,32)(H2,23,27,33) |
| InChIKey | RLVJBBIVQBRAKM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|