C21H30BN2O2S — CID 87125510
CID 87125510 (PubChem CID 87125510) has the molecular formula C21H30BN2O2S and a molecular weight of 385.36 g/mol.
| Compound Name | CID 87125510 |
|---|---|
| PubChem CID | 87125510 |
| Molecular Formula | C21H30BN2O2S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | — |
| SMILES | CCCC.CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1.[B] |
| InChI | InChI=1S/C17H20N2O2S.C4H10.B/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;1-3-4-2;/h5-12H,3-4H2,1-2H3,(H2,18,19,22);3-4H2,1-2H3; |
| InChIKey | IFQDXVJMVLSFEK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|