C25H39AlN2O2S — CID 172999227
1,3-bis(4-ethoxyphenyl)thiourea;dibutylalumane (PubChem CID 172999227) has the molecular formula C25H39AlN2O2S and a molecular weight of 458.65 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)thiourea;dibutylalumane.
| Compound Name | 1,3-bis(4-ethoxyphenyl)thiourea;dibutylalumane |
|---|---|
| PubChem CID | 172999227 |
| Molecular Formula | C25H39AlN2O2S |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)thiourea;dibutylalumane |
| SMILES | CCCC[AlH]CCCC.CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O2S.2C4H9.Al.H/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;2*1-3-4-2;;/h5-12H,3-4H2,1-2H3,(H2,18,19,22);2*1,3-4H2,2H3;; |
| InChIKey | AOGMSWLEKZKPEJ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|