C28H31HfN2O2S- — CID 87980893
1,3-bis(4-ethoxyphenyl)thiourea;1-(cyclopenta-1,3-dien-1-ylmethyl)cyclopenta-1,3-diene;hafnium (PubChem CID 87980893) has the molecular formula C28H31HfN2O2S- and a molecular weight of 638.13 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)thiourea;1-(cyclopenta-1,3-dien-1-ylmethyl)cyclopenta-1,3-diene;hafnium.
| Compound Name | 1,3-bis(4-ethoxyphenyl)thiourea;1-(cyclopenta-1,3-dien-1-ylmethyl)cyclopenta-1,3-diene;hafnium |
|---|---|
| PubChem CID | 87980893 |
| Molecular Formula | C28H31HfN2O2S- |
| Molecular Weight | 638.13 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)thiourea;1-(cyclopenta-1,3-dien-1-ylmethyl)cyclopenta-1,3-diene;hafnium |
| SMILES | C1=CCC([CH-]C2=CC=CC2)=C1.CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1.[Hf] |
| InChI | InChI=1S/C17H20N2O2S.C11H11.Hf/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;1-2-6-10(5-1)9-11-7-3-4-8-11;/h5-12H,3-4H2,1-2H3,(H2,18,19,22);1-5,7,9H,6,8H2;/q;-1; |
| InChIKey | CELREBNLNOAMKC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.13 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|