C17H24GeN2O2S — CID 172997762
1,3-bis(4-ethoxyphenyl)thiourea;germane (PubChem CID 172997762) has the molecular formula C17H24GeN2O2S and a molecular weight of 393.07 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)thiourea;germane.
| Compound Name | 1,3-bis(4-ethoxyphenyl)thiourea;germane |
|---|---|
| PubChem CID | 172997762 |
| Molecular Formula | C17H24GeN2O2S |
| Molecular Weight | 393.07 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)thiourea;germane |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1.[GeH4] |
| InChI | InChI=1S/C17H20N2O2S.GeH4/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;/h5-12H,3-4H2,1-2H3,(H2,18,19,22);1H4 |
| InChIKey | HJSIXPNDLWWOOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|