C18H22N2O4S — CID 2210976
1-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 2210976) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2210976 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-5-24-14-8-6-12(7-9-14)19-18(25)20-13-10-15(21-2)17(23-4)16(11-13)22-3/h6-11H,5H2,1-4H3,(H2,19,20,25) |
| InChIKey | JPMLXEGHQKZNNA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|