C24H32N2O5S — CID 4951613
N-[(4-heptoxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 4951613) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(4-heptoxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4951613 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[(4-heptoxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H32N2O5S/c1-5-6-7-8-9-14-31-19-12-10-18(11-13-19)25-24(32)26-23(27)17-15-20(28-2)22(30-4)21(16-17)29-3/h10-13,15-16H,5-9,14H2,1-4H3,(H2,25,26,27,32) |
| InChIKey | KVXSSXPUYHILGX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|