C21H25BrN2O2S — CID 54791479
3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]benzamide (PubChem CID 54791479) has the molecular formula C21H25BrN2O2S and a molecular weight of 449.41 g/mol. Its IUPAC name is 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54791479 |
| Molecular Formula | C21H25BrN2O2S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H25BrN2O2S/c1-2-3-4-5-6-14-26-19-12-10-18(11-13-19)23-21(27)24-20(25)16-8-7-9-17(22)15-16/h7-13,15H,2-6,14H2,1H3,(H2,23,24,25,27) |
| InChIKey | CDVWYFVFXQONCV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|