C29H34N2O4S — CID 4955369
N-[(4-heptoxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955369) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[(4-heptoxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955369 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-[(4-heptoxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-2-3-4-5-9-19-33-26-17-15-24(16-18-26)30-29(36)31-28(32)23-11-10-14-27(22-23)35-21-20-34-25-12-7-6-8-13-25/h6-8,10-18,22H,2-5,9,19-21H2,1H3,(H2,30,31,32,36) |
| InChIKey | QXIFDNBXPSZYRD-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|