C28H24N2O4S — CID 4955200
3-(2-phenoxyethoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide (PubChem CID 4955200) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4955200 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Oc2ccccc2)cc1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C28H24N2O4S/c31-27(21-8-7-13-26(20-21)33-19-18-32-23-9-3-1-4-10-23)30-28(35)29-22-14-16-25(17-15-22)34-24-11-5-2-6-12-24/h1-17,20H,18-19H2,(H2,29,30,31,35) |
| InChIKey | WDBAUMXUVXJLQW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|