C25H26N2O3S — CID 4981911
3-(3-methylbutoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide (PubChem CID 4981911) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-(3-methylbutoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-(3-methylbutoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4981911 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-(3-methylbutoxy)-N-[(4-phenoxyphenyl)carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1cccc(C(=O)NC(=S)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O3S/c1-18(2)15-16-29-23-10-6-7-19(17-23)24(28)27-25(31)26-20-11-13-22(14-12-20)30-21-8-4-3-5-9-21/h3-14,17-18H,15-16H2,1-2H3,(H2,26,27,28,31) |
| InChIKey | WLMCLAJZXOUESU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|