C27H36N2O3S — CID 17137899
N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide (PubChem CID 17137899) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17137899 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1cccc(C(=O)NC(=S)Nc2ccc(OCCC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H36N2O3S/c1-20(2)15-17-32-25-10-6-9-22(19-25)26(30)29-27(33)28-23-11-13-24(14-12-23)31-18-16-21-7-4-3-5-8-21/h6,9-14,19-21H,3-5,7-8,15-18H2,1-2H3,(H2,28,29,30,33) |
| InChIKey | FTQRXBJRDWQDMC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|