C24H28N2O4S — CID 17178646
methyl 4-[[4-(2-cyclohexylethoxy)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17178646) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is methyl 4-[[4-(2-cyclohexylethoxy)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[4-(2-cyclohexylethoxy)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178646 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 4-[[4-(2-cyclohexylethoxy)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)Nc2ccc(OCCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-29-23(28)19-9-7-18(8-10-19)22(27)26-24(31)25-20-11-13-21(14-12-20)30-16-15-17-5-3-2-4-6-17/h7-14,17H,2-6,15-16H2,1H3,(H2,25,26,27,31) |
| InChIKey | JANBLIAGZAWOEJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|