C22H24Cl2N2O2S — CID 17137923
3,5-dichloro-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17137923) has the molecular formula C22H24Cl2N2O2S and a molecular weight of 451.42 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17137923 |
| Molecular Formula | C22H24Cl2N2O2S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3,5-dichloro-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCCC2CCCCC2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N2O2S/c23-17-12-16(13-18(24)14-17)21(27)26-22(29)25-19-6-8-20(9-7-19)28-11-10-15-4-2-1-3-5-15/h6-9,12-15H,1-5,10-11H2,(H2,25,26,27,29) |
| InChIKey | SIFBKWTYXPYAQX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|