C22H25BrN2O2S — CID 17137849
2-bromo-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17137849) has the molecular formula C22H25BrN2O2S and a molecular weight of 461.43 g/mol. Its IUPAC name is 2-bromo-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17137849 |
| Molecular Formula | C22H25BrN2O2S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-bromo-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCCC2CCCCC2)cc1)c1ccccc1Br |
| InChI | InChI=1S/C22H25BrN2O2S/c23-20-9-5-4-8-19(20)21(26)25-22(28)24-17-10-12-18(13-11-17)27-15-14-16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7,14-15H2,(H2,24,25,26,28) |
| InChIKey | ANAKBDHSGJWAMF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|