C15H11BrN2O3S — CID 1328259
4-[(2-bromobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 1328259) has the molecular formula C15H11BrN2O3S and a molecular weight of 379.24 g/mol. Its IUPAC name is 4-[(2-bromobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-[(2-bromobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 1328259 |
| Molecular Formula | C15H11BrN2O3S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 4-[(2-bromobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C15H11BrN2O3S/c16-12-4-2-1-3-11(12)13(19)18-15(22)17-10-7-5-9(6-8-10)14(20)21/h1-8H,(H,20,21)(H2,17,18,19,22) |
| InChIKey | HZSUFIDCGARESS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|