C15H13BrN2O3S2 — CID 89089790
2-bromo-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 89089790) has the molecular formula C15H13BrN2O3S2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 2-bromo-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 89089790 |
| Molecular Formula | C15H13BrN2O3S2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | 2-bromo-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C15H13BrN2O3S2/c1-23(20,21)11-8-6-10(7-9-11)17-15(22)18-14(19)12-4-2-3-5-13(12)16/h2-9H,1H3,(H2,17,18,19,22) |
| InChIKey | NUQNCPXWEGTFCY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|