C16H15BrN2O4S2 — CID 89089795
3-bromo-4-methoxy-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 89089795) has the molecular formula C16H15BrN2O4S2 and a molecular weight of 443.34 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 89089795 |
| Molecular Formula | C16H15BrN2O4S2 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 3-bromo-4-methoxy-N-[(4-methylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(S(C)(=O)=O)cc2)cc1Br |
| InChI | InChI=1S/C16H15BrN2O4S2/c1-23-14-8-3-10(9-13(14)17)15(20)19-16(24)18-11-4-6-12(7-5-11)25(2,21)22/h3-9H,1-2H3,(H2,18,19,20,24) |
| InChIKey | NTPMDLDZLZXOBI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|