C19H22BrN3O5S2 — CID 17356927
3-bromo-N-[[4-(dimethylsulfamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17356927) has the molecular formula C19H22BrN3O5S2 and a molecular weight of 516.44 g/mol. Its IUPAC name is 3-bromo-N-[[4-(dimethylsulfamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-(dimethylsulfamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17356927 |
| Molecular Formula | C19H22BrN3O5S2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | 3-bromo-N-[[4-(dimethylsulfamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(C)C)cc2)cc1Br |
| InChI | InChI=1S/C19H22BrN3O5S2/c1-23(2)30(25,26)15-7-5-14(6-8-15)21-19(29)22-18(24)13-4-9-17(16(20)12-13)28-11-10-27-3/h4-9,12H,10-11H2,1-3H3,(H2,21,22,24,29) |
| InChIKey | JOWPZUUHXGIJMI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|