C16H17N3O5S2 — CID 3384811
3,4-dimethoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide (PubChem CID 3384811) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3384811 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 3,4-dimethoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C16H17N3O5S2/c1-23-13-8-3-10(9-14(13)24-2)15(20)19-16(25)18-11-4-6-12(7-5-11)26(17,21)22/h3-9H,1-2H3,(H2,17,21,22)(H2,18,19,20,25) |
| InChIKey | UYYPNTDSBHVDLW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|