C15H14F2N2O5S — CID 9314405
4-(difluoromethoxy)-3-methoxy-N-(4-sulfamoylphenyl)benzamide (PubChem CID 9314405) has the molecular formula C15H14F2N2O5S and a molecular weight of 372.35 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 9314405 |
| Molecular Formula | C15H14F2N2O5S |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-(4-sulfamoylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C15H14F2N2O5S/c1-23-13-8-9(2-7-12(13)24-15(16)17)14(20)19-10-3-5-11(6-4-10)25(18,21)22/h2-8,15H,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | IOWNHILOOHONNX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |