C20H22F2N2O4 — CID 8503672
N-[4-(diethylcarbamoyl)phenyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 8503672) has the molecular formula C20H22F2N2O4 and a molecular weight of 392.40 g/mol. Its IUPAC name is N-[4-(diethylcarbamoyl)phenyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[4-(diethylcarbamoyl)phenyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 8503672 |
| Molecular Formula | C20H22F2N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[4-(diethylcarbamoyl)phenyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc(OC(F)F)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22F2N2O4/c1-4-24(5-2)19(26)13-6-9-15(10-7-13)23-18(25)14-8-11-16(28-20(21)22)17(12-14)27-3/h6-12,20H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | OSKDGJIDQNCXOO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |