C15H13F2NO3 — CID 2171846
4-(difluoromethoxy)-3-methoxy-N-phenylbenzamide (PubChem CID 2171846) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-phenylbenzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 2171846 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-phenylbenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C15H13F2NO3/c1-20-13-9-10(7-8-12(13)21-15(16)17)14(19)18-11-5-3-2-4-6-11/h2-9,15H,1H3,(H,18,19) |
| InChIKey | CUIKYZOADWKVHC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |