C16H13F4NO4 — CID 8502681
4-(difluoromethoxy)-N-[2-(difluoromethoxy)phenyl]-3-methoxybenzamide (PubChem CID 8502681) has the molecular formula C16H13F4NO4 and a molecular weight of 359.28 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-(difluoromethoxy)phenyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-(difluoromethoxy)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 8502681 |
| Molecular Formula | C16H13F4NO4 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-(difluoromethoxy)phenyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2OC(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C16H13F4NO4/c1-23-13-8-9(6-7-12(13)25-16(19)20)14(22)21-10-4-2-3-5-11(10)24-15(17)18/h2-8,15-16H,1H3,(H,21,22) |
| InChIKey | MUEHTTVMBMOSKX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |