C17H17F2NO5 — CID 17394633
N-[2-(difluoromethoxy)phenyl]-2,4,5-trimethoxybenzamide (PubChem CID 17394633) has the molecular formula C17H17F2NO5 and a molecular weight of 353.32 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17394633 |
| Molecular Formula | C17H17F2NO5 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccccc2OC(F)F)cc1OC |
| InChI | InChI=1S/C17H17F2NO5/c1-22-13-9-15(24-3)14(23-2)8-10(13)16(21)20-11-6-4-5-7-12(11)25-17(18)19/h4-9,17H,1-3H3,(H,20,21) |
| InChIKey | RNFZZEUSSNGERJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |