C16H17NO5 — CID 7311914
N-(2-hydroxyphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 7311914) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(2-hydroxyphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7311914 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(2-hydroxyphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccccc2O)cc1OC |
| InChI | InChI=1S/C16H17NO5/c1-20-13-9-15(22-3)14(21-2)8-10(13)16(19)17-11-6-4-5-7-12(11)18/h4-9,18H,1-3H3,(H,17,19) |
| InChIKey | PNKFSQRLAFAQOO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|