C23H22N2O5 — CID 55797225
N-(3-benzamidophenyl)-2,4,5-trimethoxybenzamide (PubChem CID 55797225) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(3-benzamidophenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55797225 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-(3-benzamidophenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cccc(NC(=O)c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C23H22N2O5/c1-28-19-14-21(30-3)20(29-2)13-18(19)23(27)25-17-11-7-10-16(12-17)24-22(26)15-8-5-4-6-9-15/h4-14H,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | MXDMCDWZDCSUPV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |